C11H18N2 — CID 89129827
(1Z,3Z,5Z)-3-ethanimidoyl-7-methylocta-1,3,5-trien-1-amine (PubChem CID 89129827) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (1Z,3Z,5Z)-3-ethanimidoyl-7-methylocta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5Z)-3-ethanimidoyl-7-methylocta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 89129827 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (1Z,3Z,5Z)-3-ethanimidoyl-7-methylocta-1,3,5-trien-1-amine |
| SMILES | [H]/N=C(C)/C(/C=C\N)=C\C=C/C(C)C |
| InChI | InChI=1S/C11H18N2/c1-9(2)5-4-6-11(7-8-12)10(3)13/h4-9,13H,12H2,1-3H3/b5-4-,8-7-,11-6-,13-10+ |
| InChIKey | MQPLWDRNBGWSRT-PPSITRSSSA-N |
| XLogP | 2.64 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|