About 3-phenyl-2,3-dihydroinden-1-imine
3-phenyl-2,3-dihydroinden-1-imine (PubChem CID 89129841) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-phenyl-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | 3-phenyl-2,3-dihydroinden-1-imine |
| PubChem CID | 89129841 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-phenyl-2,3-dihydroinden-1-imine |
| SMILES | [H]/N=C1\CC(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C15H13N/c16-15-10-14(11-6-2-1-3-7-11)12-8-4-5-9-13(12)15/h1-9,14,16H,10H2/b16-15+ |
| InChIKey | HMXQAUVHVCOCNX-FOCLMDBBSA-N |
| XLogP | 3.59 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,3-dihydroinden-1-imine?
The IUPAC name of 3-phenyl-2,3-dihydroinden-1-imine (CID 89129841) is 3-phenyl-2,3-dihydroinden-1-imine.
What is the SMILES notation for 3-phenyl-2,3-dihydroinden-1-imine?
The canonical SMILES for 3-phenyl-2,3-dihydroinden-1-imine is [H]/N=C1\CC(c2ccccc2)c2ccccc21.
What is the InChIKey of 3-phenyl-2,3-dihydroinden-1-imine?
The InChIKey is HMXQAUVHVCOCNX-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H13N/c16-15-10-14(11-6-2-1-3-7-11)12-8-4-5-9-13(12)15/h1-9,14,16H,10H2/b16-15+.
What are the key properties of 3-phenyl-2,3-dihydroinden-1-imine?
3-phenyl-2,3-dihydroinden-1-imine has a molecular weight of 207.28 g/mol, XLogP of 3.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,3-dihydroinden-1-imine is sourced from PubChem (CID 89129841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).