C17H16N2O3S2 — CID 89129866
1,3-diethyl-5-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 89129866) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1,3-diethyl-5-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-diethyl-5-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 89129866 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 1,3-diethyl-5-(4-phenyl-1,3-dithiol-2-ylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)C(=C2SC=C(c3ccccc3)S2)C(=O)N(CC)C1=O |
| InChI | InChI=1S/C17H16N2O3S2/c1-3-18-14(20)13(15(21)19(4-2)17(18)22)16-23-10-12(24-16)11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | BRXXRLLYYLEQAY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|