About 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine
2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine (PubChem CID 89129881) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine.
Molecular Properties
| Compound Name | 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine |
| PubChem CID | 89129881 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine |
| SMILES | CC1CCC=c2cnncc2=N1 |
| InChI | InChI=1S/C9H11N3/c1-7-3-2-4-8-5-10-11-6-9(8)12-7/h4-7H,2-3H2,1H3 |
| InChIKey | XQSUXWFAEGPKIO-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine?
The IUPAC name of 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine (CID 89129881) is 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine is CC1CCC=c2cnncc2=N1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine?
The InChIKey is XQSUXWFAEGPKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c1-7-3-2-4-8-5-10-11-6-9(8)12-7/h4-7H,2-3H2,1H3.
What are the key properties of 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine?
2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine has a molecular weight of 161.21 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-pyridazino[4,5-b]azepine is sourced from PubChem (CID 89129881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).