About CID 89129994
CID 89129994 (PubChem CID 89129994) has the molecular formula C21H20BN5O
and a molecular weight of 369.24 g/mol.
Molecular Properties
| Compound Name | CID 89129994 |
| PubChem CID | 89129994 |
| Molecular Formula | C21H20BN5O |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2nc3cc(Oc4ccnc(CNC)c4)ccc3n2C)cc1 |
| InChI | InChI=1S/C21H20BN5O/c1-23-13-16-11-18(9-10-24-16)28-17-7-8-20-19(12-17)26-21(27(20)2)25-15-5-3-14(22)4-6-15/h3-12,23H,13H2,1-2H3,(H,25,26) |
| InChIKey | WTRUSPJUTMNXNW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 89129994 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89129994?
The IUPAC name of CID 89129994 (CID 89129994) is not available.
What is the SMILES notation for CID 89129994?
The canonical SMILES for CID 89129994 is [B]c1ccc(Nc2nc3cc(Oc4ccnc(CNC)c4)ccc3n2C)cc1.
What is the InChIKey of CID 89129994?
The InChIKey is WTRUSPJUTMNXNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20BN5O/c1-23-13-16-11-18(9-10-24-16)28-17-7-8-20-19(12-17)26-21(27(20)2)25-15-5-3-14(22)4-6-15/h3-12,23H,13H2,1-2H3,(H,25,26).
What are the key properties of CID 89129994?
CID 89129994 has a molecular weight of 369.24 g/mol, XLogP of 3.02, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89129994 is sourced from PubChem (CID 89129994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).