About (3S)-5-chloro-3-methyl-2,3-dihydropyridine
(3S)-5-chloro-3-methyl-2,3-dihydropyridine (PubChem CID 89130629) has the molecular formula C6H8ClN
and a molecular weight of 129.59 g/mol. Its IUPAC name is (3S)-5-chloro-3-methyl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | (3S)-5-chloro-3-methyl-2,3-dihydropyridine |
| PubChem CID | 89130629 |
| Molecular Formula | C6H8ClN |
| Molecular Weight | 129.59 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | (3S)-5-chloro-3-methyl-2,3-dihydropyridine |
| SMILES | C[C@H]1C=C(Cl)C=NC1 |
| InChI | InChI=1S/C6H8ClN/c1-5-2-6(7)4-8-3-5/h2,4-5H,3H2,1H3/t5-/m0/s1 |
| InChIKey | QHWPMOAKUNZNTO-YFKPBYRVSA-N |
| XLogP | 1.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.59 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3S)-5-chloro-3-methyl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-chloro-3-methyl-2,3-dihydropyridine?
The IUPAC name of (3S)-5-chloro-3-methyl-2,3-dihydropyridine (CID 89130629) is (3S)-5-chloro-3-methyl-2,3-dihydropyridine.
What is the SMILES notation for (3S)-5-chloro-3-methyl-2,3-dihydropyridine?
The canonical SMILES for (3S)-5-chloro-3-methyl-2,3-dihydropyridine is C[C@H]1C=C(Cl)C=NC1.
What is the InChIKey of (3S)-5-chloro-3-methyl-2,3-dihydropyridine?
The InChIKey is QHWPMOAKUNZNTO-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H8ClN/c1-5-2-6(7)4-8-3-5/h2,4-5H,3H2,1H3/t5-/m0/s1.
What are the key properties of (3S)-5-chloro-3-methyl-2,3-dihydropyridine?
(3S)-5-chloro-3-methyl-2,3-dihydropyridine has a molecular weight of 129.59 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-chloro-3-methyl-2,3-dihydropyridine is sourced from PubChem (CID 89130629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).