C17H20N2O8 — CID 89130649
N-[7-[(2R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxopyrano[3,2-b]pyridin-3-yl]formamide (PubChem CID 89130649) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is N-[7-[(2R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxopyrano[3,2-b]pyridin-3-yl]formamide.
| Compound Name | N-[7-[(2R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxopyrano[3,2-b]pyridin-3-yl]formamide |
|---|---|
| PubChem CID | 89130649 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[7-[(2R,5R)-3,4-dihydroxy-5-methoxy-6,6-dimethyloxan-2-yl]oxy-2-oxopyrano[3,2-b]pyridin-3-yl]formamide |
| SMILES | CO[C@@H]1C(O)C(O)[C@H](Oc2cnc3cc(NC=O)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C17H20N2O8/c1-17(2)14(24-3)12(21)13(22)16(27-17)25-8-4-11-9(18-6-8)5-10(19-7-20)15(23)26-11/h4-7,12-14,16,21-22H,1-3H3,(H,19,20)/t12?,13?,14-,16-/m1/s1 |
| InChIKey | YASUKSNGFPPEQM-UWTIDYAISA-N |
| XLogP | 0.01 |
| TPSA | 140.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|