C15H20INO6 — CID 89130761
methyl (1R,2S,6R,9R)-9-(1-iodobutyl)-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 89130761) has the molecular formula C15H20INO6 and a molecular weight of 437.23 g/mol. Its IUPAC name is methyl (1R,2S,6R,9R)-9-(1-iodobutyl)-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1R,2S,6R,9R)-9-(1-iodobutyl)-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 89130761 |
| Molecular Formula | C15H20INO6 |
| Molecular Weight | 437.23 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | methyl (1R,2S,6R,9R)-9-(1-iodobutyl)-2-methyl-4,7-dioxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | CCCC(I)[C@H]1OC[C@@]2(C(=O)OC)N1C(=O)[C@@H]1CC(=O)O[C@@]12C |
| InChI | InChI=1S/C15H20INO6/c1-4-5-9(16)12-17-11(19)8-6-10(18)23-14(8,2)15(17,7-22-12)13(20)21-3/h8-9,12H,4-7H2,1-3H3/t8-,9?,12+,14-,15-/m0/s1 |
| InChIKey | KXGRCJLGWXSMAE-YZLPNFBWSA-N |
| XLogP | 1.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|