C33H41FN8O2 — CID 89131013
2-[4-[2-amino-4-[6-[2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]piperazin-1-yl]-N-(2-ethoxyethyl)-N-methylacetamide (PubChem CID 89131013) has the molecular formula C33H41FN8O2 and a molecular weight of 600.74 g/mol. Its IUPAC name is 2-[4-[2-amino-4-[6-[2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]piperazin-1-yl]-N-(2-ethoxyethyl)-N-methylacetamide.
| Compound Name | 2-[4-[2-amino-4-[6-[2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]piperazin-1-yl]-N-(2-ethoxyethyl)-N-methylacetamide |
|---|---|
| PubChem CID | 89131013 |
| Molecular Formula | C33H41FN8O2 |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.33 |
| IUPAC Name | 2-[4-[2-amino-4-[6-[2-(3-fluorophenyl)pyrrolidin-1-yl]imidazo[1,2-b]pyridazin-3-yl]phenyl]piperazin-1-yl]-N-(2-ethoxyethyl)-N-methylacetamide |
| SMILES | CCOCCN(C)C(=O)CN1CCN(c2ccc(-c3cnc4ccc(N5CCCC5c5cccc(F)c5)nn34)cc2N)CC1 |
| InChI | InChI=1S/C33H41FN8O2/c1-3-44-19-18-38(2)33(43)23-39-14-16-40(17-15-39)29-10-9-25(21-27(29)35)30-22-36-31-11-12-32(37-42(30)31)41-13-5-8-28(41)24-6-4-7-26(34)20-24/h4,6-7,9-12,20-22,28H,3,5,8,13-19,23,35H2,1-2H3 |
| InChIKey | VZQQTCZLPURNFZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|