About 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine
4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine (PubChem CID 89131267) has the molecular formula C20H42N2
and a molecular weight of 310.57 g/mol. Its IUPAC name is 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine.
Molecular Properties
| Compound Name | 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine |
| PubChem CID | 89131267 |
| Molecular Formula | C20H42N2 |
| Molecular Weight | 310.57 g/mol |
| Exact Mass | 310.33 |
| IUPAC Name | 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine |
| SMILES | CCC(C)C/C=C\CNC(C)(C)CCCNC(C)(CC)CC |
| InChI | InChI=1S/C20H42N2/c1-8-18(4)14-11-12-16-21-19(5,6)15-13-17-22-20(7,9-2)10-3/h11-12,18,21-22H,8-10,13-17H2,1-7H3/b12-11- |
| InChIKey | LUMPLEDYBZTLNW-QXMHVHEDSA-N |
| XLogP | 5.30 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.57 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine?
The IUPAC name of 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine (CID 89131267) is 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine.
What is the SMILES notation for 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine?
The canonical SMILES for 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine is CCC(C)C/C=C\CNC(C)(C)CCCNC(C)(CC)CC.
What is the InChIKey of 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine?
The InChIKey is LUMPLEDYBZTLNW-QXMHVHEDSA-N. The full InChI is InChI=1S/C20H42N2/c1-8-18(4)14-11-12-16-21-19(5,6)15-13-17-22-20(7,9-2)10-3/h11-12,18,21-22H,8-10,13-17H2,1-7H3/b12-11-.
What are the key properties of 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine?
4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine has a molecular weight of 310.57 g/mol, XLogP of 5.30, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)pentane-1,4-diamine is sourced from PubChem (CID 89131267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).