About 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine
5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine (PubChem CID 89131268) has the molecular formula C22H46N2
and a molecular weight of 338.62 g/mol. Its IUPAC name is 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine.
Molecular Properties
| Compound Name | 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine |
| PubChem CID | 89131268 |
| Molecular Formula | C22H46N2 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 338.37 |
| IUPAC Name | 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine |
| SMILES | CCC(C)C/C=C\CNC(C)(CC)CCCCNC(C)(CC)CC |
| InChI | InChI=1S/C22H46N2/c1-8-20(5)16-12-14-18-24-22(7,11-4)17-13-15-19-23-21(6,9-2)10-3/h12,14,20,23-24H,8-11,13,15-19H2,1-7H3/b14-12- |
| InChIKey | SCEDRMULGVRDJQ-OWBHPGMISA-N |
| XLogP | 6.08 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine?
The IUPAC name of 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine (CID 89131268) is 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine.
What is the SMILES notation for 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine?
The canonical SMILES for 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine is CCC(C)C/C=C\CNC(C)(CC)CCCCNC(C)(CC)CC.
What is the InChIKey of 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine?
The InChIKey is SCEDRMULGVRDJQ-OWBHPGMISA-N. The full InChI is InChI=1S/C22H46N2/c1-8-20(5)16-12-14-18-24-22(7,11-4)17-13-15-19-23-21(6,9-2)10-3/h12,14,20,23-24H,8-11,13,15-19H2,1-7H3/b14-12-.
What are the key properties of 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine?
5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine has a molecular weight of 338.62 g/mol, XLogP of 6.08, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-5-N-[(Z)-5-methylhept-2-enyl]-1-N-(3-methylpentan-3-yl)heptane-1,5-diamine is sourced from PubChem (CID 89131268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).