C11H18BrNO — CID 89131533
(4E,5E,7E)-6-(aminomethyl)-8-bromo-4-ethylideneocta-5,7-dien-1-ol (PubChem CID 89131533) has the molecular formula C11H18BrNO and a molecular weight of 260.17 g/mol. Its IUPAC name is (4E,5E,7E)-6-(aminomethyl)-8-bromo-4-ethylideneocta-5,7-dien-1-ol.
| Compound Name | (4E,5E,7E)-6-(aminomethyl)-8-bromo-4-ethylideneocta-5,7-dien-1-ol |
|---|---|
| PubChem CID | 89131533 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (4E,5E,7E)-6-(aminomethyl)-8-bromo-4-ethylideneocta-5,7-dien-1-ol |
| SMILES | C/C=C(/C=C(\C=C\Br)CN)CCCO |
| InChI | InChI=1S/C11H18BrNO/c1-2-10(4-3-7-14)8-11(9-13)5-6-12/h2,5-6,8,14H,3-4,7,9,13H2,1H3/b6-5+,10-2+,11-8+ |
| InChIKey | DANBNPPBCCWOSR-ZGUYLISFSA-N |
| XLogP | 2.50 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|