About (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide
(Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide (PubChem CID 89131883) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide |
| PubChem CID | 89131883 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide |
| SMILES | C[C@H]1O[C@@H](N/C=C\C(N)=O)CC1O |
| InChI | InChI=1S/C8H14N2O3/c1-5-6(11)4-8(13-5)10-3-2-7(9)12/h2-3,5-6,8,10-11H,4H2,1H3,(H2,9,12)/b3-2-/t5-,6?,8-/m1/s1 |
| InChIKey | ATBJEGKBHRJOCV-RWJOMXDVSA-N |
| XLogP | -0.93 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide?
The IUPAC name of (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide (CID 89131883) is (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide.
What is the SMILES notation for (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide?
The canonical SMILES for (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide is C[C@H]1O[C@@H](N/C=C\C(N)=O)CC1O.
What is the InChIKey of (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide?
The InChIKey is ATBJEGKBHRJOCV-RWJOMXDVSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-5-6(11)4-8(13-5)10-3-2-7(9)12/h2-3,5-6,8,10-11H,4H2,1H3,(H2,9,12)/b3-2-/t5-,6?,8-/m1/s1.
What are the key properties of (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide?
(Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide has a molecular weight of 186.21 g/mol, XLogP of -0.93, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[[(2R,5R)-4-hydroxy-5-methyloxolan-2-yl]amino]prop-2-enamide is sourced from PubChem (CID 89131883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).