C58H45NO5 — CID 89131997
4-[3-[4-[N-[(3E,5E)-6-[3-(4-formylphenoxy)phenyl]hepta-1,3,5-trien-3-yl]-4-[3-(4-methylphenoxy)phenyl]anilino]phenyl]phenoxy]benzaldehyde (PubChem CID 89131997) has the molecular formula C58H45NO5 and a molecular weight of 836.00 g/mol. Its IUPAC name is 4-[3-[4-[N-[(3E,5E)-6-[3-(4-formylphenoxy)phenyl]hepta-1,3,5-trien-3-yl]-4-[3-(4-methylphenoxy)phenyl]anilino]phenyl]phenoxy]benzaldehyde.
| Compound Name | 4-[3-[4-[N-[(3E,5E)-6-[3-(4-formylphenoxy)phenyl]hepta-1,3,5-trien-3-yl]-4-[3-(4-methylphenoxy)phenyl]anilino]phenyl]phenoxy]benzaldehyde |
|---|---|
| PubChem CID | 89131997 |
| Molecular Formula | C58H45NO5 |
| Molecular Weight | 836.00 g/mol |
| Exact Mass | 835.33 |
| IUPAC Name | 4-[3-[4-[N-[(3E,5E)-6-[3-(4-formylphenoxy)phenyl]hepta-1,3,5-trien-3-yl]-4-[3-(4-methylphenoxy)phenyl]anilino]phenyl]phenoxy]benzaldehyde |
| SMILES | C=C/C(=C\C=C(/C)c1cccc(Oc2ccc(C=O)cc2)c1)N(c1ccc(-c2cccc(Oc3ccc(C)cc3)c2)cc1)c1ccc(-c2cccc(Oc3ccc(C=O)cc3)c2)cc1 |
| InChI | InChI=1S/C58H45NO5/c1-4-50(25-16-42(3)47-8-5-11-56(36-47)63-54-32-17-43(39-60)18-33-54)59(51-26-21-45(22-27-51)48-9-6-12-57(37-48)62-53-30-14-41(2)15-31-53)52-28-23-46(24-29-52)49-10-7-13-58(38-49)64-55-34-19-44(40-61)20-35-55/h4-40H,1H2,2-3H3/b42-16+,50-25+ |
| InChIKey | OXDVMQUHVGFQQO-WVZMNDSFSA-N |
| XLogP | 15.64 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.00 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|