About (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine
(Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine (PubChem CID 89132007) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine.
Molecular Properties
| Compound Name | (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine |
| PubChem CID | 89132007 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine |
| SMILES | C=C(/C=C/CCC)O/C=C\N |
| InChI | InChI=1S/C9H15NO/c1-3-4-5-6-9(2)11-8-7-10/h5-8H,2-4,10H2,1H3/b6-5+,8-7- |
| InChIKey | XRXSIBPEWJMHPF-MDAAKZFYSA-N |
| XLogP | 2.30 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine?
The IUPAC name of (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine (CID 89132007) is (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine.
What is the SMILES notation for (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine?
The canonical SMILES for (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine is C=C(/C=C/CCC)O/C=C\N.
What is the InChIKey of (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine?
The InChIKey is XRXSIBPEWJMHPF-MDAAKZFYSA-N. The full InChI is InChI=1S/C9H15NO/c1-3-4-5-6-9(2)11-8-7-10/h5-8H,2-4,10H2,1H3/b6-5+,8-7-.
What are the key properties of (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine?
(Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine has a molecular weight of 153.22 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-[(3E)-hepta-1,3-dien-2-yl]oxyethenamine is sourced from PubChem (CID 89132007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).