About 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine
6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine (PubChem CID 89132785) has the molecular formula C9H9N3S
and a molecular weight of 191.26 g/mol. Its IUPAC name is 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine |
| PubChem CID | 89132785 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine |
| SMILES | Cc1cnc(-c2cccc(N)n2)s1 |
| InChI | InChI=1S/C9H9N3S/c1-6-5-11-9(13-6)7-3-2-4-8(10)12-7/h2-5H,1H3,(H2,10,12) |
| InChIKey | NANJWQQVYGZGMS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine?
The IUPAC name of 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine (CID 89132785) is 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine.
What is the SMILES notation for 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine?
The canonical SMILES for 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine is Cc1cnc(-c2cccc(N)n2)s1.
What is the InChIKey of 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine?
The InChIKey is NANJWQQVYGZGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3S/c1-6-5-11-9(13-6)7-3-2-4-8(10)12-7/h2-5H,1H3,(H2,10,12).
What are the key properties of 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine?
6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine has a molecular weight of 191.26 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-methyl-1,3-thiazol-2-yl)pyridin-2-amine is sourced from PubChem (CID 89132785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).