C18H35N5 — CID 89132972
(4E,6E)-3,7-dimethyl-8-(1,4,7,10-tetrazacyclododec-2-yl)octa-1,4,6-trien-4-amine (PubChem CID 89132972) has the molecular formula C18H35N5 and a molecular weight of 321.51 g/mol. Its IUPAC name is (4E,6E)-3,7-dimethyl-8-(1,4,7,10-tetrazacyclododec-2-yl)octa-1,4,6-trien-4-amine.
| Compound Name | (4E,6E)-3,7-dimethyl-8-(1,4,7,10-tetrazacyclododec-2-yl)octa-1,4,6-trien-4-amine |
|---|---|
| PubChem CID | 89132972 |
| Molecular Formula | C18H35N5 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.29 |
| IUPAC Name | (4E,6E)-3,7-dimethyl-8-(1,4,7,10-tetrazacyclododec-2-yl)octa-1,4,6-trien-4-amine |
| SMILES | C=CC(C)/C(N)=C\C=C(/C)CC1CNCCNCCNCCN1 |
| InChI | InChI=1S/C18H35N5/c1-4-16(3)18(19)6-5-15(2)13-17-14-22-10-9-20-7-8-21-11-12-23-17/h4-6,16-17,20-23H,1,7-14,19H2,2-3H3/b15-5+,18-6+ |
| InChIKey | PQSJJCHREHHEKG-JYPFYAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|