C15H15F3O7 — CID 89132989
[4-oxo-4-[[(1S)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]butan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 89132989) has the molecular formula C15H15F3O7 and a molecular weight of 364.27 g/mol. Its IUPAC name is [4-oxo-4-[[(1S)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]butan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [4-oxo-4-[[(1S)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]butan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 89132989 |
| Molecular Formula | C15H15F3O7 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | [4-oxo-4-[[(1S)-5-oxo-4,8-dioxatricyclo[4.2.1.03,7]nonan-2-yl]oxy]butan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)CC(=O)OC1C2OC(=O)C3C[C@@H]1OC32)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O7/c1-5(22-13(20)6(2)15(16,17)18)3-9(19)24-11-8-4-7-10(23-8)12(11)25-14(7)21/h5,7-8,10-12H,2-4H2,1H3/t5?,7?,8-,10?,11?,12?/m0/s1 |
| InChIKey | KZEPNHILFRSLJL-AAUAVIORSA-N |
| XLogP | 1.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|