C24H46O8Si — CID 89133097
methyl (2R,3R)-2,3-dihydroxy-3-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxobutanoate (PubChem CID 89133097) has the molecular formula C24H46O8Si and a molecular weight of 490.71 g/mol. Its IUPAC name is methyl (2R,3R)-2,3-dihydroxy-3-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxobutanoate.
| Compound Name | methyl (2R,3R)-2,3-dihydroxy-3-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 89133097 |
| Molecular Formula | C24H46O8Si |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | methyl (2R,3R)-2,3-dihydroxy-3-[(4R,5S)-5-[(4R)-2-[hydroxy(dimethyl)silyl]-2,6,8-trimethylnonan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](O)[C@](O)(C=O)[C@@H]1OC(C)(C)O[C@H]1[C@H](CC(C)CC(C)C)CC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C24H46O8Si/c1-15(2)11-16(3)12-17(13-22(4,5)33(9,10)29)18-20(32-23(6,7)31-18)24(28,14-25)19(26)21(27)30-8/h14-20,26,28-29H,11-13H2,1-10H3/t16?,17-,18+,19+,20-,24-/m1/s1 |
| InChIKey | IAIBDMJTSIKBII-VNLGDWIBSA-N |
| XLogP | 3.03 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|