About (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate
(4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate (PubChem CID 89133338) has the molecular formula C8H10FNO2
and a molecular weight of 171.17 g/mol. Its IUPAC name is (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate.
Molecular Properties
| Compound Name | (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate |
| PubChem CID | 89133338 |
| Molecular Formula | C8H10FNO2 |
| Molecular Weight | 171.17 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate |
| SMILES | CNC(=O)OC1=CCC(F)C=C1 |
| InChI | InChI=1S/C8H10FNO2/c1-10-8(11)12-7-4-2-6(9)3-5-7/h2,4-6H,3H2,1H3,(H,10,11) |
| InChIKey | PJPXJYWZMIQGLE-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate?
The IUPAC name of (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate (CID 89133338) is (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate.
What is the SMILES notation for (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate?
The canonical SMILES for (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate is CNC(=O)OC1=CCC(F)C=C1.
What is the InChIKey of (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate?
The InChIKey is PJPXJYWZMIQGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO2/c1-10-8(11)12-7-4-2-6(9)3-5-7/h2,4-6H,3H2,1H3,(H,10,11).
What are the key properties of (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate?
(4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate has a molecular weight of 171.17 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorocyclohexa-1,5-dien-1-yl) N-methylcarbamate is sourced from PubChem (CID 89133338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).