About 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine
2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine (PubChem CID 89133457) has the molecular formula C13H17FN6O
and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine |
| PubChem CID | 89133457 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine |
| SMILES | Cc1nc(CF)nc(NCCCn2ccnc2N=O)c1C |
| InChI | InChI=1S/C13H17FN6O/c1-9-10(2)17-11(8-14)18-12(9)15-4-3-6-20-7-5-16-13(20)19-21/h5,7H,3-4,6,8H2,1-2H3,(H,15,17,18) |
| InChIKey | VRLCEHWWANEYSZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine?
The IUPAC name of 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine (CID 89133457) is 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine.
What is the SMILES notation for 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine?
The canonical SMILES for 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine is Cc1nc(CF)nc(NCCCn2ccnc2N=O)c1C.
What is the InChIKey of 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine?
The InChIKey is VRLCEHWWANEYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FN6O/c1-9-10(2)17-11(8-14)18-12(9)15-4-3-6-20-7-5-16-13(20)19-21/h5,7H,3-4,6,8H2,1-2H3,(H,15,17,18).
What are the key properties of 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine?
2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine has a molecular weight of 292.32 g/mol, XLogP of 2.66, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-5,6-dimethyl-N-[3-(2-nitrosoimidazol-1-yl)propyl]pyrimidin-4-amine is sourced from PubChem (CID 89133457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).