C14H11ClN6O2 — CID 8913368
N'-(3-chlorobenzoyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide (PubChem CID 8913368) has the molecular formula C14H11ClN6O2 and a molecular weight of 330.74 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
|---|---|
| PubChem CID | 8913368 |
| Molecular Formula | C14H11ClN6O2 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | N'-(3-chlorobenzoyl)-7-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbohydrazide |
| SMILES | Cc1ccnc2nc(C(=O)NNC(=O)c3cccc(Cl)c3)nn12 |
| InChI | InChI=1S/C14H11ClN6O2/c1-8-5-6-16-14-17-11(20-21(8)14)13(23)19-18-12(22)9-3-2-4-10(15)7-9/h2-7H,1H3,(H,18,22)(H,19,23) |
| InChIKey | KXYXOCCMORMJJW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|