C13H23NO — CID 89134065
(2R)-N,N-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine (PubChem CID 89134065) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2R)-N,N-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine.
| Compound Name | (2R)-N,N-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 89134065 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2R)-N,N-dimethyl-2-[(2E,4Z)-6-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine |
| SMILES | C=C(C)/C=C\C=C(/C)O[C@H](C)CN(C)C |
| InChI | InChI=1S/C13H23NO/c1-11(2)8-7-9-12(3)15-13(4)10-14(5)6/h7-9,13H,1,10H2,2-6H3/b8-7-,12-9+/t13-/m1/s1 |
| InChIKey | BOLCTUMRNKYITE-GSNYFQKJSA-N |
| XLogP | 2.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|