C19H23NO3 — CID 89134120
3-(5-aminopentyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 89134120) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(5-aminopentyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 3-(5-aminopentyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 89134120 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-(5-aminopentyl)-2,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CCCCCN |
| InChI | InChI=1S/C19H23NO3/c1-11-9-17(21)23-18-12(2)19-16(10-15(11)18)14(13(3)22-19)7-5-4-6-8-20/h9-10H,4-8,20H2,1-3H3 |
| InChIKey | BBYSLTIRXCDBHE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 69.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|