C10H12F4O2S — CID 89134607
5-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 89134607) has the molecular formula C10H12F4O2S and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)bicyclo[2.2.1]hept-2-ene.
| Compound Name | 5-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 89134607 |
| Molecular Formula | C10H12F4O2S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 5-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C10H12F4O2S/c1-17(15,16)10(13,14)9(11,12)8-5-6-2-3-7(8)4-6/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | IBENWGYWOWNGDB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|