C39H38FN5O5S — CID 89135003
[9-[3-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-3,6-bis(dimethylamino)xanthen-9-yl] formate (PubChem CID 89135003) has the molecular formula C39H38FN5O5S and a molecular weight of 707.83 g/mol. Its IUPAC name is [9-[3-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-3,6-bis(dimethylamino)xanthen-9-yl] formate.
| Compound Name | [9-[3-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-3,6-bis(dimethylamino)xanthen-9-yl] formate |
|---|---|
| PubChem CID | 89135003 |
| Molecular Formula | C39H38FN5O5S |
| Molecular Weight | 707.83 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | [9-[3-[6-[(2-cyano-5-fluoro-1,3-benzothiazol-6-yl)oxy]hexylcarbamoyl]phenyl]-3,6-bis(dimethylamino)xanthen-9-yl] formate |
| SMILES | CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C2(OC=O)c1cccc(C(=O)NCCCCCCOc2cc3sc(C#N)nc3cc2F)c1 |
| InChI | InChI=1S/C39H38FN5O5S/c1-44(2)27-12-14-29-33(19-27)50-34-20-28(45(3)4)13-15-30(34)39(29,49-24-46)26-11-9-10-25(18-26)38(47)42-16-7-5-6-8-17-48-35-22-36-32(21-31(35)40)43-37(23-41)51-36/h9-15,18-22,24H,5-8,16-17H2,1-4H3,(H,42,47) |
| InChIKey | LOKGILVIIBDGIC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 117.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.83 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|