C33H34N4O3 — CID 89135115
3-amino-N-[(2S)-4-hydroxy-1-[4-(8-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]butan-2-yl]-4-propan-2-yloxybenzamide (PubChem CID 89135115) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is 3-amino-N-[(2S)-4-hydroxy-1-[4-(8-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]butan-2-yl]-4-propan-2-yloxybenzamide.
| Compound Name | 3-amino-N-[(2S)-4-hydroxy-1-[4-(8-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]butan-2-yl]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 89135115 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 3-amino-N-[(2S)-4-hydroxy-1-[4-(8-phenylimidazo[1,2-a]pyridin-2-yl)phenyl]butan-2-yl]-4-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccc(C(=O)N[C@H](CCO)Cc2ccc(-c3cn4cccc(-c5ccccc5)c4n3)cc2)cc1N |
| InChI | InChI=1S/C33H34N4O3/c1-22(2)40-31-15-14-26(20-29(31)34)33(39)35-27(16-18-38)19-23-10-12-25(13-11-23)30-21-37-17-6-9-28(32(37)36-30)24-7-4-3-5-8-24/h3-15,17,20-22,27,38H,16,18-19,34H2,1-2H3,(H,35,39)/t27-/m1/s1 |
| InChIKey | YCRXEWYCNVVQIJ-HHHXNRCGSA-N |
| XLogP | 5.76 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|