4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride

C5H5F3O3 — CID 89135258

IUPAC4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride
SMILESCC1(C(=O)F)OCC(F)(F)O1
InChIInChI=1S/C5H5F3O3/c1-4(3(6)9)10-2-5(7,8)11-4/h2H2,1H3
InChIKeyGOQXDKMMJYUDEL-UHFFFAOYSA-N
MW170.09 g/mol
LogP0.84
Rot. Bonds1

About 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride

4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride (PubChem CID 89135258) has the molecular formula C5H5F3O3 and a molecular weight of 170.09 g/mol. Its IUPAC name is 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride.

Molecular Properties

Compound Name4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride
PubChem CID89135258
Molecular FormulaC5H5F3O3
Molecular Weight170.09 g/mol
Exact Mass170.02
IUPAC Name4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride
SMILESCC1(C(=O)F)OCC(F)(F)O1
InChIInChI=1S/C5H5F3O3/c1-4(3(6)9)10-2-5(7,8)11-4/h2H2,1H3
InChIKeyGOQXDKMMJYUDEL-UHFFFAOYSA-N
XLogP0.84
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.09
LogP ≤ 50.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride?
The IUPAC name of 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride (CID 89135258) is 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride.
What is the SMILES notation for 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride?
The canonical SMILES for 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride is CC1(C(=O)F)OCC(F)(F)O1.
What is the InChIKey of 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride?
The InChIKey is GOQXDKMMJYUDEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F3O3/c1-4(3(6)9)10-2-5(7,8)11-4/h2H2,1H3.
What are the key properties of 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride?
4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride has a molecular weight of 170.09 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-2-methyl-1,3-dioxolane-2-carbonyl fluoride is sourced from PubChem (CID 89135258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).