C24H24F7NO2 — CID 89135390
(2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol (PubChem CID 89135390) has the molecular formula C24H24F7NO2 and a molecular weight of 491.45 g/mol. Its IUPAC name is (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol.
| Compound Name | (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
|---|---|
| PubChem CID | 89135390 |
| Molecular Formula | C24H24F7NO2 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-ol |
| SMILES | C[C@@H](O[C@H]1CN2CCCC(O)[C@H]2C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H24F7NO2/c1-13(15-9-16(23(26,27)28)11-17(10-15)24(29,30)31)34-20-12-32-8-2-3-19(33)22(32)21(20)14-4-6-18(25)7-5-14/h4-7,9-11,13,19-22,33H,2-3,8,12H2,1H3/t13-,19?,20+,21?,22+/m1/s1 |
| InChIKey | CZIVHBXWKNBWQI-FAYOADSSSA-N |
| XLogP | 5.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |