C26H26F7NO3 — CID 89135459
(2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-8-methoxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one (PubChem CID 89135459) has the molecular formula C26H26F7NO3 and a molecular weight of 533.48 g/mol. Its IUPAC name is (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-8-methoxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one.
| Compound Name | (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-8-methoxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
|---|---|
| PubChem CID | 89135459 |
| Molecular Formula | C26H26F7NO3 |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | (2R,8aR)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-8-methoxy-8-methyl-1,2,3,6,7,8a-hexahydroindolizin-5-one |
| SMILES | COC1(C)CCC(=O)N2C[C@H](O[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(c3ccc(F)cc3)[C@@H]21 |
| InChI | InChI=1S/C26H26F7NO3/c1-14(16-10-17(25(28,29)30)12-18(11-16)26(31,32)33)37-20-13-34-21(35)8-9-24(2,36-3)23(34)22(20)15-4-6-19(27)7-5-15/h4-7,10-12,14,20,22-23H,8-9,13H2,1-3H3/t14-,20+,22?,23-,24?/m1/s1 |
| InChIKey | OSLUUOKOYUYNDT-BDXNPKIQSA-N |
| XLogP | 6.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |