C34H35F7N2O4 — CID 89135513
tert-butyl 4-[(2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 89135513) has the molecular formula C34H35F7N2O4 and a molecular weight of 668.65 g/mol. Its IUPAC name is tert-butyl 4-[(2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89135513 |
| Molecular Formula | C34H35F7N2O4 |
| Molecular Weight | 668.65 g/mol |
| Exact Mass | 668.25 |
| IUPAC Name | tert-butyl 4-[(2R)-2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-5-oxo-2,3,8,8a-tetrahydro-1H-indolizin-7-yl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(O[C@H]1CN2C(=O)C=C(C3=CCN(C(=O)OC(C)(C)C)CC3)CC2C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H35F7N2O4/c1-19(22-13-24(33(36,37)38)17-25(14-22)34(39,40)41)46-28-18-43-27(30(28)21-5-7-26(35)8-6-21)15-23(16-29(43)44)20-9-11-42(12-10-20)31(45)47-32(2,3)4/h5-9,13-14,16-17,19,27-28,30H,10-12,15,18H2,1-4H3/t19?,27?,28-,30?/m0/s1 |
| InChIKey | ARPGHLPKBSIRIH-CYOQRPCTSA-N |
| XLogP | 8.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.65 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |