C8H11IO2 — CID 89135517
(1'S,5'S)-6'-iodospiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] (PubChem CID 89135517) has the molecular formula C8H11IO2 and a molecular weight of 266.08 g/mol. Its IUPAC name is (1'S,5'S)-6'-iodospiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane].
| Compound Name | (1'S,5'S)-6'-iodospiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
|---|---|
| PubChem CID | 89135517 |
| Molecular Formula | C8H11IO2 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | (1'S,5'S)-6'-iodospiro[1,3-dioxolane-2,2'-bicyclo[3.1.0]hexane] |
| SMILES | IC1[C@H]2CCC3(OCCO3)[C@@H]12 |
| InChI | InChI=1S/C8H11IO2/c9-7-5-1-2-8(6(5)7)10-3-4-11-8/h5-7H,1-4H2/t5-,6+,7?/m0/s1 |
| InChIKey | VSRLWABJMMSLDP-GFCOJPQKSA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|