C12H18N2O3 — CID 89135584
(2S,3R,4R)-7-(ethylperoxymethyl)-3-(methoxymethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene (PubChem CID 89135584) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is (2S,3R,4R)-7-(ethylperoxymethyl)-3-(methoxymethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene.
| Compound Name | (2S,3R,4R)-7-(ethylperoxymethyl)-3-(methoxymethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene |
|---|---|
| PubChem CID | 89135584 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | (2S,3R,4R)-7-(ethylperoxymethyl)-3-(methoxymethyl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),6-diene |
| SMILES | CCOOCc1[nH]nc2c1C[C@H]1[C@@H](COC)[C@@H]21 |
| InChI | InChI=1S/C12H18N2O3/c1-3-16-17-6-10-8-4-7-9(5-15-2)11(7)12(8)14-13-10/h7,9,11H,3-6H2,1-2H3,(H,13,14)/t7-,9+,11-/m0/s1 |
| InChIKey | KGMQECVJHZWGPS-NMLBEHRDSA-N |
| XLogP | 1.41 |
| TPSA | 56.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|