C10H15F3O — CID 89135602
(Z,3E)-1,1,1-trifluoro-3-propylidenehept-4-en-2-ol (PubChem CID 89135602) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is (Z,3E)-1,1,1-trifluoro-3-propylidenehept-4-en-2-ol.
| Compound Name | (Z,3E)-1,1,1-trifluoro-3-propylidenehept-4-en-2-ol |
|---|---|
| PubChem CID | 89135602 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (Z,3E)-1,1,1-trifluoro-3-propylidenehept-4-en-2-ol |
| SMILES | CC/C=C\C(=C/CC)C(O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O/c1-3-5-7-8(6-4-2)9(14)10(11,12)13/h5-7,9,14H,3-4H2,1-2H3/b7-5-,8-6+ |
| InChIKey | NOSZTBHQOYFLIX-CGXWXWIYSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|