C34H39N3O3 — CID 89135660
(E)-N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 89135660) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is (E)-N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 89135660 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (E)-N-[(1R,2S)-2-[(3aR,4S,9bR)-4-cyclohexa-2,4-dien-1-yl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carbonyl]cyclohexyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)N[C@@H]2CCCC[C@@H]2C(=O)N2CC[C@@H]3[C@H](C4C=CC=CC4)Nc4ccccc4[C@@H]32)cc1 |
| InChI | InChI=1S/C34H39N3O3/c1-40-25-18-15-23(16-19-25)17-20-31(38)35-30-14-8-6-12-27(30)34(39)37-22-21-28-32(24-9-3-2-4-10-24)36-29-13-7-5-11-26(29)33(28)37/h2-5,7,9,11,13,15-20,24,27-28,30,32-33,36H,6,8,10,12,14,21-22H2,1H3,(H,35,38)/b20-17+/t24?,27-,28+,30+,32-,33-/m0/s1 |
| InChIKey | PCEZALRLHGNJIS-XZCXOIJBSA-N |
| XLogP | 5.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|