About (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene
(1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene (PubChem CID 89136276) has the molecular formula C6H6ClF
and a molecular weight of 132.56 g/mol. Its IUPAC name is (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene.
Molecular Properties
| Compound Name | (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene |
| PubChem CID | 89136276 |
| Molecular Formula | C6H6ClF |
| Molecular Weight | 132.56 g/mol |
| Exact Mass | 132.01 |
| IUPAC Name | (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene |
| SMILES | C=C/C=C(Cl)\C=C\F |
| InChI | InChI=1S/C6H6ClF/c1-2-3-6(7)4-5-8/h2-5H,1H2/b5-4+,6-3+ |
| InChIKey | SRKRDVBEXGJWNS-UTTVJGTNSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.56 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene?
The IUPAC name of (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene (CID 89136276) is (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene.
What is the SMILES notation for (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene?
The canonical SMILES for (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene is C=C/C=C(Cl)\C=C\F.
What is the InChIKey of (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene?
The InChIKey is SRKRDVBEXGJWNS-UTTVJGTNSA-N. The full InChI is InChI=1S/C6H6ClF/c1-2-3-6(7)4-5-8/h2-5H,1H2/b5-4+,6-3+.
What are the key properties of (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene?
(1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene has a molecular weight of 132.56 g/mol, XLogP of 2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3E)-3-chloro-1-fluorohexa-1,3,5-triene is sourced from PubChem (CID 89136276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).