C10H22O7P2 — CID 89136477
diethoxyphosphoryl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methanol (PubChem CID 89136477) has the molecular formula C10H22O7P2 and a molecular weight of 316.23 g/mol. Its IUPAC name is diethoxyphosphoryl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methanol.
| Compound Name | diethoxyphosphoryl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methanol |
|---|---|
| PubChem CID | 89136477 |
| Molecular Formula | C10H22O7P2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | diethoxyphosphoryl-(5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methanol |
| SMILES | CCOP(=O)(OCC)C(O)P1(=O)OCC(C)(C)CO1 |
| InChI | InChI=1S/C10H22O7P2/c1-5-14-18(12,15-6-2)9(11)19(13)16-7-10(3,4)8-17-19/h9,11H,5-8H2,1-4H3 |
| InChIKey | OHWBOWXDSIDDJZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|