C39H39FO4S4 — CID 89136884
octyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate (PubChem CID 89136884) has the molecular formula C39H39FO4S4 and a molecular weight of 719.00 g/mol. Its IUPAC name is octyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate.
| Compound Name | octyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89136884 |
| Molecular Formula | C39H39FO4S4 |
| Molecular Weight | 719.00 g/mol |
| Exact Mass | 718.17 |
| IUPAC Name | octyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1sc2c(C)sc(-c3cc4cc5c(OCC)c6cc7sc(C)cc7cc6c(OCC)c5cc4s3)c2c1F |
| InChI | InChI=1S/C39H39FO4S4/c1-6-9-10-11-12-13-14-44-39(41)38-33(40)32-36(48-38)22(5)46-37(32)31-18-24-17-26-28(20-30(24)47-31)34(42-7-2)25-16-23-15-21(4)45-29(23)19-27(25)35(26)43-8-3/h15-20H,6-14H2,1-5H3 |
| InChIKey | JYEBZDGMFSAFNG-UHFFFAOYSA-N |
| XLogP | 13.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.00 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|