C51H63FO4S4 — CID 89136894
octyl 3-fluoro-6-methyl-4-(17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)thieno[2,3-c]thiophene-2-carboxylate (PubChem CID 89136894) has the molecular formula C51H63FO4S4 and a molecular weight of 887.33 g/mol. Its IUPAC name is octyl 3-fluoro-6-methyl-4-(17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)thieno[2,3-c]thiophene-2-carboxylate.
| Compound Name | octyl 3-fluoro-6-methyl-4-(17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)thieno[2,3-c]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89136894 |
| Molecular Formula | C51H63FO4S4 |
| Molecular Weight | 887.33 g/mol |
| Exact Mass | 886.36 |
| IUPAC Name | octyl 3-fluoro-6-methyl-4-(17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)thieno[2,3-c]thiophene-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1sc2c(C)sc(-c3cc4cc5c(OCCCCCCCC)c6cc7sc(C)cc7cc6c(OCCCCCCCC)c5cc4s3)c2c1F |
| InChI | InChI=1S/C51H63FO4S4/c1-6-9-12-15-18-21-24-54-46-37-28-35-27-33(4)57-41(35)31-39(37)47(55-25-22-19-16-13-10-7-2)38-29-36-30-43(59-42(36)32-40(38)46)49-44-45(52)50(60-48(44)34(5)58-49)51(53)56-26-23-20-17-14-11-8-3/h27-32H,6-26H2,1-5H3 |
| InChIKey | KQSBFIGNSBVAKI-UHFFFAOYSA-N |
| XLogP | 18.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.33 |
| LogP ≤ 5 | 18.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|