C33H27FO4S4 — CID 89136930
ethyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate (PubChem CID 89136930) has the molecular formula C33H27FO4S4 and a molecular weight of 634.84 g/mol. Its IUPAC name is ethyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate.
| Compound Name | ethyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 89136930 |
| Molecular Formula | C33H27FO4S4 |
| Molecular Weight | 634.84 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | ethyl 4-(2,12-diethoxy-17-methyl-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaen-7-yl)-3-fluoro-6-methylthieno[2,3-c]thiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2c(C)sc(-c3cc4cc5c(OCC)c6cc7sc(C)cc7cc6c(OCC)c5cc4s3)c2c1F |
| InChI | InChI=1S/C33H27FO4S4/c1-6-36-28-19-10-17-9-15(4)39-23(17)13-21(19)29(37-7-2)20-11-18-12-25(41-24(18)14-22(20)28)31-26-27(34)32(33(35)38-8-3)42-30(26)16(5)40-31/h9-14H,6-8H2,1-5H3 |
| InChIKey | QNNDHGYQTNLSST-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.84 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|