C17H17N5O4S — CID 89137077
2-[4-(4-cyano-1-methyltriazolo[4,5-c]pyridin-6-yl)-2-methylphenoxy]ethyl methanesulfonate (PubChem CID 89137077) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-[4-(4-cyano-1-methyltriazolo[4,5-c]pyridin-6-yl)-2-methylphenoxy]ethyl methanesulfonate.
| Compound Name | 2-[4-(4-cyano-1-methyltriazolo[4,5-c]pyridin-6-yl)-2-methylphenoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 89137077 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 2-[4-(4-cyano-1-methyltriazolo[4,5-c]pyridin-6-yl)-2-methylphenoxy]ethyl methanesulfonate |
| SMILES | Cc1cc(-c2cc3c(nnn3C)c(C#N)n2)ccc1OCCOS(C)(=O)=O |
| InChI | InChI=1S/C17H17N5O4S/c1-11-8-12(4-5-16(11)25-6-7-26-27(3,23)24)13-9-15-17(14(10-18)19-13)20-21-22(15)2/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | TYWJFYBJWYWIEG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|