C27H46O — CID 89137191
(3R)-3-[(3S,10R,13R,14S)-3,4,4,10,13,14-hexamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal (PubChem CID 89137191) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is (3R)-3-[(3S,10R,13R,14S)-3,4,4,10,13,14-hexamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal.
| Compound Name | (3R)-3-[(3S,10R,13R,14S)-3,4,4,10,13,14-hexamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
|---|---|
| PubChem CID | 89137191 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | (3R)-3-[(3S,10R,13R,14S)-3,4,4,10,13,14-hexamethyl-2,3,5,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]butanal |
| SMILES | C[C@H](CC=O)C1CC[C@@]2(C)C3CCC4C(C)(C)[C@@H](C)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C27H46O/c1-18(13-17-28)20-11-15-27(7)22-8-9-23-24(3,4)19(2)10-14-25(23,5)21(22)12-16-26(20,27)6/h17-23H,8-16H2,1-7H3/t18-,19+,20?,21?,22?,23?,25-,26-,27+/m1/s1 |
| InChIKey | GQUXKOZAEVEORE-HSVPICGOSA-N |
| XLogP | 7.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|