C25H27NO — CID 89137494
(3S)-3-ethenyl-6-methoxy-7,10-dimethyl-2-prop-2-enyl-3,4-dihydro-1H-phenanthro[9,10-c]pyridine (PubChem CID 89137494) has the molecular formula C25H27NO and a molecular weight of 357.50 g/mol. Its IUPAC name is (3S)-3-ethenyl-6-methoxy-7,10-dimethyl-2-prop-2-enyl-3,4-dihydro-1H-phenanthro[9,10-c]pyridine.
| Compound Name | (3S)-3-ethenyl-6-methoxy-7,10-dimethyl-2-prop-2-enyl-3,4-dihydro-1H-phenanthro[9,10-c]pyridine |
|---|---|
| PubChem CID | 89137494 |
| Molecular Formula | C25H27NO |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3S)-3-ethenyl-6-methoxy-7,10-dimethyl-2-prop-2-enyl-3,4-dihydro-1H-phenanthro[9,10-c]pyridine |
| SMILES | C=CCN1Cc2c(c3cc(OC)c(C)cc3c3cc(C)ccc23)C[C@H]1C=C |
| InChI | InChI=1S/C25H27NO/c1-6-10-26-15-24-19-9-8-16(3)11-20(19)21-12-17(4)25(27-5)14-23(21)22(24)13-18(26)7-2/h6-9,11-12,14,18H,1-2,10,13,15H2,3-5H3/t18-/m1/s1 |
| InChIKey | ODPNERYJODLUFD-GOSISDBHSA-N |
| XLogP | 5.72 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|