C35H16O5 — CID 89137751
7-oxadecacyclo[14.14.2.22,5.217,20.03,12.04,9.013,31.018,27.019,24.028,32]hexatriaconta-1(31),2,4,9,11,15,17(34),18(27),19(24),20(33),25,28(32),29,35-tetradecaene-6,8,21,23-tetrone (PubChem CID 89137751) has the molecular formula C35H16O5 and a molecular weight of 516.51 g/mol. Its IUPAC name is 7-oxadecacyclo[14.14.2.22,5.217,20.03,12.04,9.013,31.018,27.019,24.028,32]hexatriaconta-1(31),2,4,9,11,15,17(34),18(27),19(24),20(33),25,28(32),29,35-tetradecaene-6,8,21,23-tetrone.
| Compound Name | 7-oxadecacyclo[14.14.2.22,5.217,20.03,12.04,9.013,31.018,27.019,24.028,32]hexatriaconta-1(31),2,4,9,11,15,17(34),18(27),19(24),20(33),25,28(32),29,35-tetradecaene-6,8,21,23-tetrone |
|---|---|
| PubChem CID | 89137751 |
| Molecular Formula | C35H16O5 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 7-oxadecacyclo[14.14.2.22,5.217,20.03,12.04,9.013,31.018,27.019,24.028,32]hexatriaconta-1(31),2,4,9,11,15,17(34),18(27),19(24),20(33),25,28(32),29,35-tetradecaene-6,8,21,23-tetrone |
| SMILES | O=C1OC(=O)c2ccc3c4c(ccc1c24)-c1ccc2c4c1C3CC=c4c1ccc3c4c(ccc2c41)C(=O)CC3=O |
| InChI | InChI=1S/C35H16O5/c36-26-13-27(37)23-10-6-19-15-2-4-17-21-8-12-25-33-24(34(38)40-35(25)39)11-7-20(31(21)33)16-3-1-14(28(15)29(16)17)18-5-9-22(26)32(23)30(18)19/h1-3,5-12,17H,4,13H2 |
| InChIKey | SHXVLOMGZHEBTA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|