C14H19F6NO4 — CID 89137928
1-O-tert-butyl 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperidine-1,4-dicarboxylate (PubChem CID 89137928) has the molecular formula C14H19F6NO4 and a molecular weight of 379.30 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-tert-butyl 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89137928 |
| Molecular Formula | C14H19F6NO4 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-O-tert-butyl 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperidine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H19F6NO4/c1-12(2,3)25-11(23)21-6-4-8(5-7-21)9(22)24-10(13(15,16)17)14(18,19)20/h8,10H,4-7H2,1-3H3 |
| InChIKey | VKDAXIANSNPPPJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |