C15H20F7NO4 — CID 89137930
2-methylbutan-2-yl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)piperidine-1-carboxylate (PubChem CID 89137930) has the molecular formula C15H20F7NO4 and a molecular weight of 411.31 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)piperidine-1-carboxylate.
| Compound Name | 2-methylbutan-2-yl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89137930 |
| Molecular Formula | C15H20F7NO4 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-methylbutan-2-yl 4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)piperidine-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F7NO4/c1-4-12(2,3)27-11(25)23-7-5-9(6-8-23)26-10(24)13(16,17)14(18,19)15(20,21)22/h9H,4-8H2,1-3H3 |
| InChIKey | ZCDBIFYXSQGBQA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|