C15H21F6NO4 — CID 89137935
4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2-methylbutan-2-yl) piperidine-1,4-dicarboxylate (PubChem CID 89137935) has the molecular formula C15H21F6NO4 and a molecular weight of 393.32 g/mol. Its IUPAC name is 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2-methylbutan-2-yl) piperidine-1,4-dicarboxylate.
| Compound Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2-methylbutan-2-yl) piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 89137935 |
| Molecular Formula | C15H21F6NO4 |
| Molecular Weight | 393.32 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 4-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) 1-O-(2-methylbutan-2-yl) piperidine-1,4-dicarboxylate |
| SMILES | CCC(C)(C)OC(=O)N1CCC(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F6NO4/c1-4-13(2,3)26-12(24)22-7-5-9(6-8-22)10(23)25-11(14(16,17)18)15(19,20)21/h9,11H,4-8H2,1-3H3 |
| InChIKey | UVUPFFDQQVNTLY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |