C17H27N — CID 89138171
4-tert-butyl-N-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-amine (PubChem CID 89138171) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 4-tert-butyl-N-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-amine.
| Compound Name | 4-tert-butyl-N-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 89138171 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 4-tert-butyl-N-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\CCC)NC1C=CC(C(C)(C)C)=CC1 |
| InChI | InChI=1S/C17H27N/c1-6-8-9-15(7-2)18-16-12-10-14(11-13-16)17(3,4)5/h7,9-12,16,18H,2,6,8,13H2,1,3-5H3/b15-9+ |
| InChIKey | BZMPPJATDBMJPD-OQLLNIDSSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|