C21H23NO5 — CID 89138209
6-[(3E,5E)-3,5-dimethyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-hydroxy-3,5-dimethylpyran-2-one (PubChem CID 89138209) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 6-[(3E,5E)-3,5-dimethyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-hydroxy-3,5-dimethylpyran-2-one.
| Compound Name | 6-[(3E,5E)-3,5-dimethyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-hydroxy-3,5-dimethylpyran-2-one |
|---|---|
| PubChem CID | 89138209 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 6-[(3E,5E)-3,5-dimethyl-6-(4-nitrophenyl)hexa-3,5-dienyl]-4-hydroxy-3,5-dimethylpyran-2-one |
| SMILES | CC(=C\c1ccc([N+](=O)[O-])cc1)/C=C(\C)CCc1oc(=O)c(C)c(O)c1C |
| InChI | InChI=1S/C21H23NO5/c1-13(5-10-19-15(3)20(23)16(4)21(24)27-19)11-14(2)12-17-6-8-18(9-7-17)22(25)26/h6-9,11-12,23H,5,10H2,1-4H3/b13-11+,14-12+ |
| InChIKey | UERDCRYIPVUCBM-PHEQNACWSA-N |
| XLogP | 4.85 |
| TPSA | 93.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|