C10H15I — CID 89138232
(3E,5Z)-4-iodo-2,6-dimethylocta-1,3,5-triene (PubChem CID 89138232) has the molecular formula C10H15I and a molecular weight of 262.13 g/mol. Its IUPAC name is (3E,5Z)-4-iodo-2,6-dimethylocta-1,3,5-triene.
| Compound Name | (3E,5Z)-4-iodo-2,6-dimethylocta-1,3,5-triene |
|---|---|
| PubChem CID | 89138232 |
| Molecular Formula | C10H15I |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (3E,5Z)-4-iodo-2,6-dimethylocta-1,3,5-triene |
| SMILES | C=C(C)/C=C(I)\C=C(\C)CC |
| InChI | InChI=1S/C10H15I/c1-5-9(4)7-10(11)6-8(2)3/h6-7H,2,5H2,1,3-4H3/b9-7-,10-6+ |
| InChIKey | FRXFWIIZLLQJLR-ODUODFHUSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|